Products 943-45-3
CAS 943-45-3 appears in our catalog under these names: 2-Methyl-2-phenoxy-propionic acid, 95%, 2-Methyl-2-phenoxypropionic Acid, >98.0%(GC)(T), 2-Methyl-2-phenoxypropanoic acid 98%, 2-Methyl-2-phenoxypropanoic acid, 98%, 98%, 2-methyl-2-phenoxypropanoic acid, 98%. Offered by: Combi-blocks, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg, 10g.
2-methyl-2-phenoxypropanoic acid (CAS 943-45-3) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 2-methyl-2-phenoxypropanoic acid. InChIKey: ILPUOPPYSQEBNJ-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 2-methyl-2-phenoxypropanoic acid |
| InChIKey | ILPUOPPYSQEBNJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)OC1=CC=CC=C1 |
Computed by PubChem (NCBI)
Synonyms:
Phenoxyisobutyric acid, fibric acid, 2-Phenoxyisobutyric acid, 2-Methyl-2-phenoxypropionic acid, 2-phenoxy-2-methylpropionic acid, methyl-2-phenoxypropanoic acid, 2-methyl-2-phenoxypropanoic acid, 2-methyl-2-phenoxy-propanoic acid, 2-Methyl-2-phenoxy-propionic acid, Propanoic acid, 2-methyl-2-phenoxy-