Products 943057-12-3
CAS 943057-12-3 is the registry number for Adriforant. Offered by: MedChemExpress. Available pack sizes: 50 mg, 25 mg, 5 mg, 100 mg, 10 mg, 1 mg.
4-N-(cyclopropylmethyl)-6-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyrimidine-2,4-diamine (CAS 943057-12-3) is a chemical compound with the molecular formula C13H22N6 and a molecular weight of 262.35 g/mol. IUPAC name: 4-N-(cyclopropylmethyl)-6-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyrimidine-2,4-diamine. InChIKey: ISBHYKVAFKTATD-SNVBAGLBSA-N.
| Molecular formula | C13H22N6 |
|---|---|
| Molecular weight | 262.35 g/mol |
| IUPAC name | 4-N-(cyclopropylmethyl)-6-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyrimidine-2,4-diamine |
| InChIKey | ISBHYKVAFKTATD-SNVBAGLBSA-N |
| SMILES | CN[C@@H]1CCN(C1)C2=NC(=NC(=C2)NCC3CC3)N |
Computed by PubChem (NCBI)