CAS 943118-99-8 appears in our catalog under these names: Cyclopentyl(4-fluorophenyl)methanamine, 95%, Cyclopentyl(4-fluorophenyl)methanamine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 2,5g.
Cyclopentyl-(4-fluorophenyl)methanamine (CAS 943118-99-8) is a chemical compound with the molecular formula C12H16FN and a molecular weight of 193.26 g/mol. IUPAC name: cyclopentyl-(4-fluorophenyl)methanamine. InChIKey: NTNLGQWPYJTABN-UHFFFAOYSA-N.
| Molecular formula | C12H16FN |
|---|---|
| Molecular weight | 193.26 g/mol |
| IUPAC name | cyclopentyl-(4-fluorophenyl)methanamine |
| InChIKey | NTNLGQWPYJTABN-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C(C2=CC=C(C=C2)F)N |
Computed by PubChem (NCBI)