CAS 94324-23-9 appears in our catalog under these names: 5-Bromo-5-deoxy-2,3-O-isopropylidene-D-ribono-1,4-lactone, 5-Bromo-5-deoxy-2,3-isopropylidene-D-ribonolactone. Offered by: Biosynth, MedChemExpress. Available pack sizes: 500mg, 250mg, 1000mg, 5000mg, 2000mg, Get quote.
6-(bromomethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one (CAS 94324-23-9) is a chemical compound with the molecular formula C8H11BrO4 and a molecular weight of 251.07 g/mol. IUPAC name: 6-(bromomethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one. InChIKey: ZSWDFLIWNDCXNU-UHFFFAOYSA-N.
| Molecular formula | C8H11BrO4 |
|---|---|
| Molecular weight | 251.07 g/mol |
| IUPAC name | 6-(bromomethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
| InChIKey | ZSWDFLIWNDCXNU-UHFFFAOYSA-N |
| SMILES | CC1(OC2C(OC(=O)C2O1)CBr)C |
Computed by PubChem (NCBI)