CAS 943311-35-1 appears in our catalog under these names: 5-Fluoro-6-nitrobenzo[c][1,2]oxaborol-1(3H)-ol, 98%, 98%, 5-Fluoro-6-nitrobenzo[c][1,2]oxaborol-1(3H)-ol, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g.
5-fluoro-1-hydroxy-6-nitro-3H-2,1-benzoxaborole (CAS 943311-35-1) is a chemical compound with the molecular formula C7H5BFNO4 and a molecular weight of 196.93 g/mol. IUPAC name: 5-fluoro-1-hydroxy-6-nitro-3H-2,1-benzoxaborole. InChIKey: QOQMJYSGCZLJFD-UHFFFAOYSA-N.
| Molecular formula | C7H5BFNO4 |
|---|---|
| Molecular weight | 196.93 g/mol |
| IUPAC name | 5-fluoro-1-hydroxy-6-nitro-3H-2,1-benzoxaborole |
| InChIKey | QOQMJYSGCZLJFD-UHFFFAOYSA-N |
| SMILES | B1(C2=CC(=C(C=C2CO1)F)[N+](=O)[O-])O |
Computed by PubChem (NCBI)