CAS 943331-64-4 appears in our catalog under these names: 4-Hydroxyvoriconazole, 4-Hydroxy Voriconazole, Voriconazole Impurity 57. Offered by: Biosynth, Chemat Brand. Available pack sizes: 10mg, on request.
(2R,3R)-3-(2,4-difluorophenyl)-2-(5-fluoropyrimidin-4-yl)-4-(1,2,4-triazol-1-yl)butane-1,3-diol (CAS 943331-64-4) is a chemical compound with the molecular formula C16H14F3N5O2 and a molecular weight of 365.31 g/mol. IUPAC name: (2R,3R)-3-(2,4-difluorophenyl)-2-(5-fluoropyrimidin-4-yl)-4-(1,2,4-triazol-1-yl)butane-1,3-diol. InChIKey: BGPPSFHHAYWTMX-LRDDRELGSA-N.
| Molecular formula | C16H14F3N5O2 |
|---|---|
| Molecular weight | 365.31 g/mol |
| IUPAC name | (2R,3R)-3-(2,4-difluorophenyl)-2-(5-fluoropyrimidin-4-yl)-4-(1,2,4-triazol-1-yl)butane-1,3-diol |
| InChIKey | BGPPSFHHAYWTMX-LRDDRELGSA-N |
| SMILES | C1=CC(=C(C=C1F)F)[C@@](CN2C=NC=N2)([C@@H](CO)C3=NC=NC=C3F)O |
Computed by PubChem (NCBI)