CAS 94339-59-0 is the registry number for 1,2,3-Trichloro-5-(3,4-dichlorophenoxy)benzene. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
1,2,3-trichloro-5-(3,4-dichlorophenoxy)benzene (CAS 94339-59-0) is a chemical compound with the molecular formula C12H5Cl5O and a molecular weight of 342.4 g/mol. IUPAC name: 1,2,3-trichloro-5-(3,4-dichlorophenoxy)benzene. InChIKey: WDBLKMRZRGLISL-UHFFFAOYSA-N.
| Molecular formula | C12H5Cl5O |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | 1,2,3-trichloro-5-(3,4-dichlorophenoxy)benzene |
| InChIKey | WDBLKMRZRGLISL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC2=CC(=C(C(=C2)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)