CAS 943423-30-1 is the registry number for 2-Tritylsulfanyl-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-tritylsulfanylbenzoic acid (CAS 943423-30-1) is a chemical compound with the molecular formula C26H20O2S and a molecular weight of 396.5 g/mol. IUPAC name: 2-tritylsulfanylbenzoic acid. InChIKey: GXCHJIJPSMUELN-UHFFFAOYSA-N.
| Molecular formula | C26H20O2S |
|---|---|
| Molecular weight | 396.5 g/mol |
| IUPAC name | 2-tritylsulfanylbenzoic acid |
| InChIKey | GXCHJIJPSMUELN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)SC4=CC=CC=C4C(=O)O |
Computed by PubChem (NCBI)