Products 943423-30-1

CAS 943423-30-1 is the registry number for 2-Tritylsulfanyl-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-tritylsulfanylbenzoic acid (CAS 943423-30-1) is a chemical compound with the molecular formula C26H20O2S and a molecular weight of 396.5 g/mol. IUPAC name: 2-tritylsulfanylbenzoic acid. InChIKey: GXCHJIJPSMUELN-UHFFFAOYSA-N.

Identity
Molecular formulaC26H20O2S
Molecular weight396.5 g/mol
IUPAC name2-tritylsulfanylbenzoic acid
InChIKeyGXCHJIJPSMUELN-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)SC4=CC=CC=C4C(=O)O

Computed by PubChem (NCBI)