CAS 943545-68-4 is the registry number for 2,3',4,5',6-Pentakis(dihydrogen phosphate)(1,1'-biphenyl)-2,3',4,5',6-pentol. Offered by: TRC. Available pack sizes: 50mg.
[2-(3,5-diphosphonooxyphenyl)-3,5-diphosphonooxyphenyl] dihydrogen phosphate (CAS 943545-68-4) is a chemical compound with the molecular formula C12H15O20P5 and a molecular weight of 634.10 g/mol. IUPAC name: [2-(3,5-diphosphonooxyphenyl)-3,5-diphosphonooxyphenyl] dihydrogen phosphate. InChIKey: ZCSNVIKBMFGCLE-UHFFFAOYSA-N.
| Molecular formula | C12H15O20P5 |
|---|---|
| Molecular weight | 634.10 g/mol |
| IUPAC name | [2-(3,5-diphosphonooxyphenyl)-3,5-diphosphonooxyphenyl] dihydrogen phosphate |
| InChIKey | ZCSNVIKBMFGCLE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OP(=O)(O)O)OP(=O)(O)O)C2=C(C=C(C=C2OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O |
Computed by PubChem (NCBI)