Products 94367-56-3
CAS 94367-56-3 is the registry number for 4-Methylbiphenyl-d3. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-phenyl-4-(trideuteriomethyl)benzene (CAS 94367-56-3) is a chemical compound with the molecular formula C13H12 and a molecular weight of 171.25 g/mol. IUPAC name: 1-phenyl-4-(trideuteriomethyl)benzene. InChIKey: ZZLCFHIKESPLTH-FIBGUPNXSA-N.
| Molecular formula | C13H12 |
|---|---|
| Molecular weight | 171.25 g/mol |
| IUPAC name | 1-phenyl-4-(trideuteriomethyl)benzene |
| InChIKey | ZZLCFHIKESPLTH-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC=C(C=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
1-phenyl-4-(trideuteriomethyl)benzene, 4-Methyl-d