CAS 943750-62-7 is the registry number for Rel-5-((3S,5R)-3,5-dimethylpiperazin-1-yl)pyridin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyridin-2-amine (CAS 943750-62-7) is a chemical compound with the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. IUPAC name: 5-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyridin-2-amine. InChIKey: UXPVYPKUBZTKIP-DTORHVGOSA-N.
| Molecular formula | C11H18N4 |
|---|---|
| Molecular weight | 206.29 g/mol |
| IUPAC name | 5-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyridin-2-amine |
| InChIKey | UXPVYPKUBZTKIP-DTORHVGOSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](N1)C)C2=CN=C(C=C2)N |
Computed by PubChem (NCBI)