CAS 94376-75-7 appears in our catalog under these names: Bis(3-PEG6)propionic acid, 97%, Bis–PEG7–acid, MAL-dPEG®,4-t-boc-Hydrazide, Bis-PEG7-acid 98%, 4,7,10,13,16,19,22-Heptaoxapentacosanedioic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 1000mg, 100mg, 10g, 25mg, 50 mg.
3-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 94376-75-7) is a chemical compound with the molecular formula C18H34O11 and a molecular weight of 426.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: AYUREXAVZVVOJM-UHFFFAOYSA-N.
| Molecular formula | C18H34O11 |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | AYUREXAVZVVOJM-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)