CAS 943825-42-1 is the registry number for 6–chloro–3–(6–methyl–2–oxo–2H–chromene–3–carbonyl)–2H–chromen–2–one. Offered by: GLPBio. Available pack sizes: 5mg.
3-(6-chloro-2-oxochromene-3-carbonyl)-6-methylchromen-2-one (CAS 943825-42-1) is a chemical compound with the molecular formula C20H11ClO5 and a molecular weight of 366.7 g/mol. IUPAC name: 3-(6-chloro-2-oxochromene-3-carbonyl)-6-methylchromen-2-one. InChIKey: FLWBWYJSWIFXDU-UHFFFAOYSA-N.
| Molecular formula | C20H11ClO5 |
|---|---|
| Molecular weight | 366.7 g/mol |
| IUPAC name | 3-(6-chloro-2-oxochromene-3-carbonyl)-6-methylchromen-2-one |
| InChIKey | FLWBWYJSWIFXDU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)OC(=O)C(=C2)C(=O)C3=CC4=C(C=CC(=C4)Cl)OC3=O |
Computed by PubChem (NCBI)