CAS 944279-23-6 is the registry number for 4–(2–(Dimethylamino)ethoxy)–3–fluorophenylboronic acid. Offered by: GLPBio. Available pack sizes: 5g.
[4-[2-(dimethylamino)ethoxy]-3-fluorophenyl]boronic acid (CAS 944279-23-6) is a chemical compound with the molecular formula C10H15BFNO3 and a molecular weight of 227.04 g/mol. IUPAC name: [4-[2-(dimethylamino)ethoxy]-3-fluorophenyl]boronic acid. InChIKey: WIRZCZXOJWPDTM-UHFFFAOYSA-N.
| Molecular formula | C10H15BFNO3 |
|---|---|
| Molecular weight | 227.04 g/mol |
| IUPAC name | [4-[2-(dimethylamino)ethoxy]-3-fluorophenyl]boronic acid |
| InChIKey | WIRZCZXOJWPDTM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCCN(C)C)F)(O)O |
Computed by PubChem (NCBI)