CAS 944351-63-7 appears in our catalog under these names: 1-(3-(Trifluoromethyl)phenyl)cyclohexane-1-carbonitrile, 95%, 1-(3-(Trifluoromethyl)phenyl)cyclohexane-1-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
1-[3-(trifluoromethyl)phenyl]cyclohexane-1-carbonitrile (CAS 944351-63-7) is a chemical compound with the molecular formula C14H14F3N and a molecular weight of 253.26 g/mol. IUPAC name: 1-[3-(trifluoromethyl)phenyl]cyclohexane-1-carbonitrile. InChIKey: IQGDWHBCFPWBSV-UHFFFAOYSA-N.
| Molecular formula | C14H14F3N |
|---|---|
| Molecular weight | 253.26 g/mol |
| IUPAC name | 1-[3-(trifluoromethyl)phenyl]cyclohexane-1-carbonitrile |
| InChIKey | IQGDWHBCFPWBSV-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C#N)C2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)