CAS 944401-63-2 is the registry number for 4-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine, 98%. Offered by: AmBeed. Available pack sizes: 5g.
4-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine (CAS 944401-63-2) is a chemical compound with the molecular formula C11H18BN3O3 and a molecular weight of 251.09 g/mol. IUPAC name: 4-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine. InChIKey: ACMUXYYKNYNMBI-UHFFFAOYSA-N.
| Molecular formula | C11H18BN3O3 |
|---|---|
| Molecular weight | 251.09 g/mol |
| IUPAC name | 4-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
| InChIKey | ACMUXYYKNYNMBI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2OC)N |
Computed by PubChem (NCBI)