CAS 944476-44-2 appears in our catalog under these names: Sofosbuvir Impurity 111, Sofosbuvir Impurity 114, Sofosbuvir Impurity 118. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(2R,3R,4R,5R)-3-benzoyloxy-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-4-methyloxolan-2-yl]methyl benzoate (CAS 944476-44-2) is a chemical compound with the molecular formula C24H22N2O8 and a molecular weight of 466.4 g/mol. IUPAC name: [(2R,3R,4R,5R)-3-benzoyloxy-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-4-methyloxolan-2-yl]methyl benzoate. InChIKey: SYOIECTUIXEQLV-PDKZGUECSA-N.
| Molecular formula | C24H22N2O8 |
|---|---|
| Molecular weight | 466.4 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-3-benzoyloxy-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-4-methyloxolan-2-yl]methyl benzoate |
| InChIKey | SYOIECTUIXEQLV-PDKZGUECSA-N |
| SMILES | C[C@]1([C@@H]([C@H](O[C@H]1N2C=CC(=O)NC2=O)COC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)O |
Computed by PubChem (NCBI)