Products 944510-83-2

CAS 944510-83-2 is the registry number for Ethyl 2-(4-(4-bromophenylamino)-3,5-thiazolyl)acetate. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.

Structural formula: {0} (CAS {1})

Ethyl 2-[2-(4-bromoanilino)-1,3-thiazol-4-yl]acetate (CAS 944510-83-2) is a chemical compound with the molecular formula C13H13BrN2O2S and a molecular weight of 341.23 g/mol. IUPAC name: ethyl 2-[2-(4-bromoanilino)-1,3-thiazol-4-yl]acetate. InChIKey: COKOUOOHSJWONP-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13BrN2O2S
Molecular weight341.23 g/mol
IUPAC nameethyl 2-[2-(4-bromoanilino)-1,3-thiazol-4-yl]acetate
InChIKeyCOKOUOOHSJWONP-UHFFFAOYSA-N
SMILESCCOC(=O)CC1=CSC(=N1)NC2=CC=C(C=C2)Br

Computed by PubChem (NCBI)