CAS 944709-53-9 is the registry number for Pomalidomide Impurity 23. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dichloro-[1,3]oxazolo[5,4-d]pyrimidine (CAS 944709-53-9) is a chemical compound with the molecular formula C5HCl2N3O and a molecular weight of 189.98 g/mol. IUPAC name: 5,7-dichloro-[1,3]oxazolo[5,4-d]pyrimidine. InChIKey: RLOQLWRJZNTGQX-UHFFFAOYSA-N.
| Molecular formula | C5HCl2N3O |
|---|---|
| Molecular weight | 189.98 g/mol |
| IUPAC name | 5,7-dichloro-[1,3]oxazolo[5,4-d]pyrimidine |
| InChIKey | RLOQLWRJZNTGQX-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(O1)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)