CAS 944795-06-6 appears in our catalog under these names: Lck inhibitor 2, 95%, Lck inhibitor 2, Lck inhibitor 2 98%, Lck inhibitor 2, 99.73%, 3-[[4-[(5-Hydroxy-2-methylphenyl)amino]-2-pyrimidinyl]amino]benzamide, 98%, 98%. Offered by: Combi-blocks, TargetMol, Ambeed, MedChemExpress, Chemat. Available pack sizes: 100mg, 2mg, 5mg, 10mg, 25mg, 50mg, 250mg, 50 mg.
3-[[4-(5-hydroxy-2-methylanilino)pyrimidin-2-yl]amino]benzamide (CAS 944795-06-6) is a chemical compound with the molecular formula C18H17N5O2 and a molecular weight of 335.4 g/mol. IUPAC name: 3-[[4-(5-hydroxy-2-methylanilino)pyrimidin-2-yl]amino]benzamide. InChIKey: SFCBIFOAGRZJNX-UHFFFAOYSA-N.
| Molecular formula | C18H17N5O2 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 3-[[4-(5-hydroxy-2-methylanilino)pyrimidin-2-yl]amino]benzamide |
| InChIKey | SFCBIFOAGRZJNX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)O)NC2=NC(=NC=C2)NC3=CC=CC(=C3)C(=O)N |
Computed by PubChem (NCBI)