Products 944919-15-7
CAS 944919-15-7 is the registry number for (+)-JNJ-37654032. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(5,6-dichloro-1H-benzimidazol-2-yl)-1,1,1-trifluorobut-3-en-2-ol (CAS 944919-15-7) is a chemical compound with the molecular formula C11H7Cl2F3N2O and a molecular weight of 311.08 g/mol. IUPAC name: 2-(5,6-dichloro-1H-benzimidazol-2-yl)-1,1,1-trifluorobut-3-en-2-ol. InChIKey: HEDZSNUSVHSSQI-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2F3N2O |
|---|---|
| Molecular weight | 311.08 g/mol |
| IUPAC name | 2-(5,6-dichloro-1H-benzimidazol-2-yl)-1,1,1-trifluorobut-3-en-2-ol |
| InChIKey | HEDZSNUSVHSSQI-UHFFFAOYSA-N |
| SMILES | C=CC(C1=NC2=CC(=C(C=C2N1)Cl)Cl)(C(F)(F)F)O |
Computed by PubChem (NCBI)