CAS 945023-32-5 appears in our catalog under these names: 1-Methyl-5-(trifluoromethyl)-1h-benzimidazol-2-amine hydrobromide, 95%, 1-Methyl-5-(trifluoromethyl)-1H-benzo(d)imidazol-2-amine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-methyl-5-(trifluoromethyl)benzimidazol-2-amine;hydrobromide (CAS 945023-32-5) is a chemical compound with the molecular formula C9H9BrF3N3 and a molecular weight of 296.09 g/mol. IUPAC name: 1-methyl-5-(trifluoromethyl)benzimidazol-2-amine;hydrobromide. InChIKey: MTDWPFVJDSLMHC-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF3N3 |
|---|---|
| Molecular weight | 296.09 g/mol |
| IUPAC name | 1-methyl-5-(trifluoromethyl)benzimidazol-2-amine;hydrobromide |
| InChIKey | MTDWPFVJDSLMHC-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C(F)(F)F)N=C1N.Br |
Computed by PubChem (NCBI)