CAS 945119-78-8 is the registry number for TNIK modulator-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-anilino-5-[(4-methoxybenzoyl)amino]-1,3-thiazole-4-carboxamide (CAS 945119-78-8) is a chemical compound with the molecular formula C18H16N4O3S and a molecular weight of 368.4 g/mol. IUPAC name: 2-anilino-5-[(4-methoxybenzoyl)amino]-1,3-thiazole-4-carboxamide. InChIKey: CGFNTHSTIRJUDZ-UHFFFAOYSA-N.
| Molecular formula | C18H16N4O3S |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 2-anilino-5-[(4-methoxybenzoyl)amino]-1,3-thiazole-4-carboxamide |
| InChIKey | CGFNTHSTIRJUDZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)NC2=C(N=C(S2)NC3=CC=CC=C3)C(=O)N |
Computed by PubChem (NCBI)