Products 945142-65-4

CAS 945142-65-4 is the registry number for E6-272, 99.93%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 100 mg, 10mM/1mL, 5 mg, 50 mg.

Structural formula: {0} (CAS {1})

N-(1-benzylpiperidin-4-yl)-2-(4-phenylphenyl)acetamide (CAS 945142-65-4) is a chemical compound with the molecular formula C26H28N2O and a molecular weight of 384.5 g/mol. IUPAC name: N-(1-benzylpiperidin-4-yl)-2-(4-phenylphenyl)acetamide. InChIKey: SLAFBAGJEVMCMT-UHFFFAOYSA-N.

Identity
Molecular formulaC26H28N2O
Molecular weight384.5 g/mol
IUPAC nameN-(1-benzylpiperidin-4-yl)-2-(4-phenylphenyl)acetamide
InChIKeySLAFBAGJEVMCMT-UHFFFAOYSA-N
SMILESC1CN(CCC1NC(=O)CC2=CC=C(C=C2)C3=CC=CC=C3)CC4=CC=CC=C4

Computed by PubChem (NCBI)