CAS 945244-26-8 is the registry number for Diethyl 2-(2-bromo-4-nitrophenyl)-2-methylmalonate, 98%. Offered by: AmBeed. Available pack sizes: 250mg.
Diethyl 2-(2-bromo-4-nitrophenyl)-2-methylpropanedioate (CAS 945244-26-8) is a chemical compound with the molecular formula C14H16BrNO6 and a molecular weight of 374.18 g/mol. IUPAC name: diethyl 2-(2-bromo-4-nitrophenyl)-2-methylpropanedioate. InChIKey: KMTCLWUMAULDAN-UHFFFAOYSA-N.
| Molecular formula | C14H16BrNO6 |
|---|---|
| Molecular weight | 374.18 g/mol |
| IUPAC name | diethyl 2-(2-bromo-4-nitrophenyl)-2-methylpropanedioate |
| InChIKey | KMTCLWUMAULDAN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C1=C(C=C(C=C1)[N+](=O)[O-])Br)C(=O)OCC |
Computed by PubChem (NCBI)