Products 945459-98-3

CAS 945459-98-3 is the registry number for 1-Methylphosphinane-4-carboxylic acid 1-oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-methyl-1-oxo-1lambda5-phosphinane-4-carboxylic acid (CAS 945459-98-3) is a chemical compound with the molecular formula C7H13O3P and a molecular weight of 176.15 g/mol. IUPAC name: 1-methyl-1-oxo-1lambda5-phosphinane-4-carboxylic acid. InChIKey: CHZBTICQVOMFDP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13O3P
Molecular weight176.15 g/mol
IUPAC name1-methyl-1-oxo-1lambda5-phosphinane-4-carboxylic acid
InChIKeyCHZBTICQVOMFDP-UHFFFAOYSA-N
SMILESCP1(=O)CCC(CC1)C(=O)O

Computed by PubChem (NCBI)