CAS 94549-87-8 is the registry number for Dimethyl-4,4’-dithiobiscinnamate. Offered by: TRC. Available pack sizes: 1g, 2g, 500mg.
Methyl (E)-3-[4-[[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]disulfanyl]phenyl]prop-2-enoate (CAS 94549-87-8) is a chemical compound with the molecular formula C20H18O4S2 and a molecular weight of 386.5 g/mol. IUPAC name: methyl (E)-3-[4-[[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]disulfanyl]phenyl]prop-2-enoate. InChIKey: QYHBBSNMUBIDTK-FNCQTZNRSA-N.
| Molecular formula | C20H18O4S2 |
|---|---|
| Molecular weight | 386.5 g/mol |
| IUPAC name | methyl (E)-3-[4-[[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]disulfanyl]phenyl]prop-2-enoate |
| InChIKey | QYHBBSNMUBIDTK-FNCQTZNRSA-N |
| SMILES | COC(=O)/C=C/C1=CC=C(C=C1)SSC2=CC=C(C=C2)/C=C/C(=O)OC |
Computed by PubChem (NCBI)