CAS 945599-35-9 is the registry number for tert-Butyl 4-iodo-1H-pyrazolo(3,4-b)pyridine-1-carboxylate, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl 4-iodopyrazolo[3,4-b]pyridine-1-carboxylate (CAS 945599-35-9) is a chemical compound with the molecular formula C11H12IN3O2 and a molecular weight of 345.14 g/mol. IUPAC name: tert-butyl 4-iodopyrazolo[3,4-b]pyridine-1-carboxylate. InChIKey: BDZNHHNQSQMWGF-UHFFFAOYSA-N.
| Molecular formula | C11H12IN3O2 |
|---|---|
| Molecular weight | 345.14 g/mol |
| IUPAC name | tert-butyl 4-iodopyrazolo[3,4-b]pyridine-1-carboxylate |
| InChIKey | BDZNHHNQSQMWGF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=NC=CC(=C2C=N1)I |
Computed by PubChem (NCBI)