CAS 945614-12-0 appears in our catalog under these names: Pexmetinib, Pexmetinib (ARRY–614), Pexmetinib/ 99.07% (existing batch purity), Pexmetinib 99%, Pexmetinib, 99%, 99%. Offered by: TRC, GLPBio, TargetMol, Ambeed, Chemat. Available pack sizes: 100mg, 25mg, 5mg, 1mg, 10mg, 10mM (in 1ml dmso), 50mg, 2mg.
1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[[5-fluoro-2-[1-(2-hydroxyethyl)indazol-5-yl]oxyphenyl]methyl]urea (CAS 945614-12-0) is a chemical compound with the molecular formula C31H33FN6O3 and a molecular weight of 556.6 g/mol. IUPAC name: 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[[5-fluoro-2-[1-(2-hydroxyethyl)indazol-5-yl]oxyphenyl]methyl]urea. InChIKey: LNMRSSIMGCDUTP-UHFFFAOYSA-N.
| Molecular formula | C31H33FN6O3 |
|---|---|
| Molecular weight | 556.6 g/mol |
| IUPAC name | 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[[5-fluoro-2-[1-(2-hydroxyethyl)indazol-5-yl]oxyphenyl]methyl]urea |
| InChIKey | LNMRSSIMGCDUTP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=CC(=N2)C(C)(C)C)NC(=O)NCC3=C(C=CC(=C3)F)OC4=CC5=C(C=C4)N(N=C5)CCO |
Computed by PubChem (NCBI)