CAS 945623-67-6 is the registry number for N-Methyl-N-(trimethylsilyl)trifluoroacetamide-d9. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 10 mg, 100 mg.
2,2,2-trifluoro-N-methyl-N-[tris(trideuteriomethyl)silyl]acetamide (CAS 945623-67-6) is a chemical compound with the molecular formula C6H12F3NOSi and a molecular weight of 208.30 g/mol. IUPAC name: 2,2,2-trifluoro-N-methyl-N-[tris(trideuteriomethyl)silyl]acetamide. InChIKey: MSPCIZMDDUQPGJ-WVZRYRIDSA-N.
| Molecular formula | C6H12F3NOSi |
|---|---|
| Molecular weight | 208.30 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-methyl-N-[tris(trideuteriomethyl)silyl]acetamide |
| InChIKey | MSPCIZMDDUQPGJ-WVZRYRIDSA-N |
| SMILES | [2H]C([2H])([2H])[Si](C([2H])([2H])[2H])(C([2H])([2H])[2H])N(C)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)