CAS 945668-94-0 appears in our catalog under these names: Quetiapine EP Impurity D, 11,11'-Piperazine-1,4-diylbis(dibenzo(b,f)(1,4)thiazepine), Quetiapine Dimer Impurity, >95% (HPLC), Quetiapine Dimer Impurity, 11,11'-(1,4-Piperazinediyl)bis-dibenzo(b,f)(1,4)thiazepine. Offered by: Chemat Brand, Mikromol, TRC, GLPBio, Biosynth. Available pack sizes: on request, 25mg, 10mg, 5mg, 1mg, 2mg, 10g, 5g.
6-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)benzo[b][1,4]benzothiazepine (CAS 945668-94-0) is a chemical compound with the molecular formula C30H24N4S2 and a molecular weight of 504.7 g/mol. IUPAC name: 6-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)benzo[b][1,4]benzothiazepine. InChIKey: MFQIBYYFBRAARW-UHFFFAOYSA-N.
| Molecular formula | C30H24N4S2 |
|---|---|
| Molecular weight | 504.7 g/mol |
| IUPAC name | 6-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)benzo[b][1,4]benzothiazepine |
| InChIKey | MFQIBYYFBRAARW-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=NC3=CC=CC=C3SC4=CC=CC=C42)C5=NC6=CC=CC=C6SC7=CC=CC=C75 |
Computed by PubChem (NCBI)