CAS 945675-82-1 is the registry number for (4-Bromophenyl)methyl-beta-D-glucopyranoside. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
(2R,3R,4S,5S,6R)-2-[(4-bromophenyl)methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 945675-82-1) is a chemical compound with the molecular formula C13H17BrO6 and a molecular weight of 349.17 g/mol. IUPAC name: (2R,3R,4S,5S,6R)-2-[(4-bromophenyl)methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: PTQSDKWCEKULBE-UJPOAAIJSA-N.
| Molecular formula | C13H17BrO6 |
|---|---|
| Molecular weight | 349.17 g/mol |
| IUPAC name | (2R,3R,4S,5S,6R)-2-[(4-bromophenyl)methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | PTQSDKWCEKULBE-UJPOAAIJSA-N |
| SMILES | C1=CC(=CC=C1CO[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)Br |
Computed by PubChem (NCBI)