CAS 945760-93-0 is the registry number for Potassium (4-tert-butylcyclohex-1-en-1-yl)trifluoroborate, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Potassium (4-tert-butylcyclohexen-1-yl)-trifluoroboranuide (CAS 945760-93-0) is a chemical compound with the molecular formula C10H17BF3K and a molecular weight of 244.15 g/mol. IUPAC name: potassium (4-tert-butylcyclohexen-1-yl)-trifluoroboranuide. InChIKey: RBCQCXDFQCEHGR-UHFFFAOYSA-N.
| Molecular formula | C10H17BF3K |
|---|---|
| Molecular weight | 244.15 g/mol |
| IUPAC name | potassium (4-tert-butylcyclohexen-1-yl)-trifluoroboranuide |
| InChIKey | RBCQCXDFQCEHGR-UHFFFAOYSA-N |
| SMILES | [B-](C1=CCC(CC1)C(C)(C)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)