Products 945771-96-0
CAS 945771-96-0 is the registry number for BNC105P. Offered by: MedChemExpress. Available pack sizes: Get quote.
Disodium;[6-methoxy-2-methyl-3-(3,4,5-trimethoxybenzoyl)-1-benzofuran-7-yl] phosphate (CAS 945771-96-0) is a chemical compound with the molecular formula C20H19Na2O10P and a molecular weight of 496.3 g/mol. IUPAC name: disodium;[6-methoxy-2-methyl-3-(3,4,5-trimethoxybenzoyl)-1-benzofuran-7-yl] phosphate. InChIKey: VVIPLWCZZYERCA-UHFFFAOYSA-L.
| Molecular formula | C20H19Na2O10P |
|---|---|
| Molecular weight | 496.3 g/mol |
| IUPAC name | disodium;[6-methoxy-2-methyl-3-(3,4,5-trimethoxybenzoyl)-1-benzofuran-7-yl] phosphate |
| InChIKey | VVIPLWCZZYERCA-UHFFFAOYSA-L |
| SMILES | CC1=C(C2=C(O1)C(=C(C=C2)OC)OP(=O)([O-])[O-])C(=O)C3=CC(=C(C(=C3)OC)OC)OC.[Na+].[Na+] |
Computed by PubChem (NCBI)