CAS 945859-86-9 is the registry number for Boc-protected photo-Leu(tBu). Offered by: MedChemExpress. Available pack sizes: Get quote.
Tert-butyl (2S)-4-(3-methyldiazirin-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 945859-86-9) is a chemical compound with the molecular formula C15H27N3O4 and a molecular weight of 313.39 g/mol. IUPAC name: tert-butyl (2S)-4-(3-methyldiazirin-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: IJBFOBOICMVZMK-JTQLQIEISA-N.
| Molecular formula | C15H27N3O4 |
|---|---|
| Molecular weight | 313.39 g/mol |
| IUPAC name | tert-butyl (2S)-4-(3-methyldiazirin-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | IJBFOBOICMVZMK-JTQLQIEISA-N |
| SMILES | CC1(N=N1)CC[C@@H](C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)