CAS 945950-80-1 is the registry number for (S)-4-Chloro-2,3-dihydro-1H-inden-1-amine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
(1S)-4-chloro-2,3-dihydro-1H-inden-1-amine (CAS 945950-80-1) is a chemical compound with the molecular formula C9H10ClN and a molecular weight of 167.63 g/mol. IUPAC name: (1S)-4-chloro-2,3-dihydro-1H-inden-1-amine. InChIKey: AAXBDGLLOGVNDN-VIFPVBQESA-N.
| Molecular formula | C9H10ClN |
|---|---|
| Molecular weight | 167.63 g/mol |
| IUPAC name | (1S)-4-chloro-2,3-dihydro-1H-inden-1-amine |
| InChIKey | AAXBDGLLOGVNDN-VIFPVBQESA-N |
| SMILES | C1CC2=C([C@H]1N)C=CC=C2Cl |
Computed by PubChem (NCBI)