CAS 94609-23-1 is the registry number for Ethyl (2E)-4,4,4-trifluoro-2-(hydroxyimino)-3-oxobutanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Ethyl 4,4,4-trifluoro-3-hydroxy-2-nitrosobut-2-enoate (CAS 94609-23-1) is a chemical compound with the molecular formula C6H6F3NO4 and a molecular weight of 213.11 g/mol. IUPAC name: ethyl 4,4,4-trifluoro-3-hydroxy-2-nitrosobut-2-enoate. InChIKey: ADLCTQSTKWOPJT-UHFFFAOYSA-N.
| Molecular formula | C6H6F3NO4 |
|---|---|
| Molecular weight | 213.11 g/mol |
| IUPAC name | ethyl 4,4,4-trifluoro-3-hydroxy-2-nitrosobut-2-enoate |
| InChIKey | ADLCTQSTKWOPJT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=C(C(F)(F)F)O)N=O |
Computed by PubChem (NCBI)