CAS 946123-12-2 appears in our catalog under these names: Coumarin 343 X NHS ester, 95%, Coumarin 343 X NHS ester, Coumarin 343 X NHS ester. Offered by: Lumiprobe, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg, 10 mg, 5 mg.
(2,5-dioxopyrrolidin-1-yl) 6-[(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carbonyl)amino]hexanoate (CAS 946123-12-2) is a chemical compound with the molecular formula C26H29N3O7 and a molecular weight of 495.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 6-[(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carbonyl)amino]hexanoate. InChIKey: UTYUORAKIFFNAS-UHFFFAOYSA-N.
| Molecular formula | C26H29N3O7 |
|---|---|
| Molecular weight | 495.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 6-[(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carbonyl)amino]hexanoate |
| InChIKey | UTYUORAKIFFNAS-UHFFFAOYSA-N |
| SMILES | C1CC2=C3C(=C4C(=C2)C=C(C(=O)O4)C(=O)NCCCCCC(=O)ON5C(=O)CCC5=O)CCCN3C1 |
Computed by PubChem (NCBI)