CAS 946386-01-2 is the registry number for 2-Chloro-5,5-dimethyl-3-(4-phenylpiperazinyl)cyclohex-2-en-1-one. Offered by: Biosynth. Available pack sizes: 5000mg.
2-chloro-5,5-dimethyl-3-(4-phenylpiperazin-1-yl)cyclohex-2-en-1-one (CAS 946386-01-2) is a chemical compound with the molecular formula C18H23ClN2O and a molecular weight of 318.8 g/mol. IUPAC name: 2-chloro-5,5-dimethyl-3-(4-phenylpiperazin-1-yl)cyclohex-2-en-1-one. InChIKey: MQCURPCZFZHOIN-UHFFFAOYSA-N.
| Molecular formula | C18H23ClN2O |
|---|---|
| Molecular weight | 318.8 g/mol |
| IUPAC name | 2-chloro-5,5-dimethyl-3-(4-phenylpiperazin-1-yl)cyclohex-2-en-1-one |
| InChIKey | MQCURPCZFZHOIN-UHFFFAOYSA-N |
| SMILES | CC1(CC(=C(C(=O)C1)Cl)N2CCN(CC2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)