CAS 946386-71-6 is the registry number for 2-Iodo-5,5-dimethyl-3-((3-nitrophenyl)amino)cyclohex-2-en-1-one. Offered by: Biosynth. Available pack sizes: 5000mg.
2-iodo-5,5-dimethyl-3-(3-nitroanilino)cyclohex-2-en-1-one (CAS 946386-71-6) is a chemical compound with the molecular formula C14H15IN2O3 and a molecular weight of 386.18 g/mol. IUPAC name: 2-iodo-5,5-dimethyl-3-(3-nitroanilino)cyclohex-2-en-1-one. InChIKey: RPBCMJHDZYVLQM-UHFFFAOYSA-N.
| Molecular formula | C14H15IN2O3 |
|---|---|
| Molecular weight | 386.18 g/mol |
| IUPAC name | 2-iodo-5,5-dimethyl-3-(3-nitroanilino)cyclohex-2-en-1-one |
| InChIKey | RPBCMJHDZYVLQM-UHFFFAOYSA-N |
| SMILES | CC1(CC(=C(C(=O)C1)I)NC2=CC(=CC=C2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)