CAS 946386-85-2 is the registry number for N-(4-(4,5-dichloroimidazolyl)phenyl)(2-chloro(3-pyridyl))formamide. Offered by: Biosynth. Available pack sizes: 500mg, 1000mg, 2000mg.
2-chloro-N-[4-(4,5-dichloroimidazol-1-yl)phenyl]pyridine-3-carboxamide (CAS 946386-85-2) is a chemical compound with the molecular formula C15H9Cl3N4O and a molecular weight of 367.6 g/mol. IUPAC name: 2-chloro-N-[4-(4,5-dichloroimidazol-1-yl)phenyl]pyridine-3-carboxamide. InChIKey: WEGJRMZXHHVWOE-UHFFFAOYSA-N.
| Molecular formula | C15H9Cl3N4O |
|---|---|
| Molecular weight | 367.6 g/mol |
| IUPAC name | 2-chloro-N-[4-(4,5-dichloroimidazol-1-yl)phenyl]pyridine-3-carboxamide |
| InChIKey | WEGJRMZXHHVWOE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)Cl)C(=O)NC2=CC=C(C=C2)N3C=NC(=C3Cl)Cl |
Computed by PubChem (NCBI)