CAS 946386-99-8 is the registry number for N-(3,5-Bis(trifluoromethyl)phenyl)-2-indol-3-yl-2-oxoethanamide. Offered by: Biosynth. Available pack sizes: 5000mg.
N-[3,5-bis(trifluoromethyl)phenyl]-2-(1H-indol-3-yl)-2-oxoacetamide (CAS 946386-99-8) is a chemical compound with the molecular formula C18H10F6N2O2 and a molecular weight of 400.3 g/mol. IUPAC name: N-[3,5-bis(trifluoromethyl)phenyl]-2-(1H-indol-3-yl)-2-oxoacetamide. InChIKey: KWDDUDBRESDVEO-UHFFFAOYSA-N.
| Molecular formula | C18H10F6N2O2 |
|---|---|
| Molecular weight | 400.3 g/mol |
| IUPAC name | N-[3,5-bis(trifluoromethyl)phenyl]-2-(1H-indol-3-yl)-2-oxoacetamide |
| InChIKey | KWDDUDBRESDVEO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(=O)C(=O)NC3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)