Products 946387-16-2
CAS 946387-16-2 is the registry number for 2-(4,5-dichloroimidazolyl)-N-(2-indol-3-ylethyl)ethanamide. Offered by: Biosynth. Available pack sizes: 500mg, 1000mg, 2000mg.
2-(4,5-dichloroimidazol-1-yl)-N-[2-(1H-indol-3-yl)ethyl]acetamide (CAS 946387-16-2) is a chemical compound with the molecular formula C15H14Cl2N4O and a molecular weight of 337.2 g/mol. IUPAC name: 2-(4,5-dichloroimidazol-1-yl)-N-[2-(1H-indol-3-yl)ethyl]acetamide. InChIKey: WTCYFZCMORCSSA-UHFFFAOYSA-N.
| Molecular formula | C15H14Cl2N4O |
|---|---|
| Molecular weight | 337.2 g/mol |
| IUPAC name | 2-(4,5-dichloroimidazol-1-yl)-N-[2-(1H-indol-3-yl)ethyl]acetamide |
| InChIKey | WTCYFZCMORCSSA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCNC(=O)CN3C=NC(=C3Cl)Cl |
Computed by PubChem (NCBI)