CAS 946387-32-2 is the registry number for 3-(4-(tert-butyl)phenyl)-5-indol-3-yl-1H,4H,5H-1,2-diazin-6-one. Offered by: Biosynth. Available pack sizes: 500mg, 1000mg, 2000mg.
3-(4-tert-butylphenyl)-5-(1H-indol-3-yl)-4,5-dihydro-1H-pyridazin-6-one (CAS 946387-32-2) is a chemical compound with the molecular formula C22H23N3O and a molecular weight of 345.4 g/mol. IUPAC name: 3-(4-tert-butylphenyl)-5-(1H-indol-3-yl)-4,5-dihydro-1H-pyridazin-6-one. InChIKey: VJFZZNIMQBQZRE-UHFFFAOYSA-N.
| Molecular formula | C22H23N3O |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | 3-(4-tert-butylphenyl)-5-(1H-indol-3-yl)-4,5-dihydro-1H-pyridazin-6-one |
| InChIKey | VJFZZNIMQBQZRE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=NNC(=O)C(C2)C3=CNC4=CC=CC=C43 |
Computed by PubChem (NCBI)