Products 946400-19-7
CAS 946400-19-7 appears in our catalog under these names: 11β-HSD1 inibitor 19, 11β-HSD1 inibitor 19/ 99.46% (existing batch purity). Offered by: Chemat, TargetMol. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
3-chloro-4-[(2R)-4-[4-fluoro-2-(trifluoromethyl)phenyl]-2-methylpiperazin-1-yl]sulfonylbenzonitrile (CAS 946400-19-7) is a chemical compound with the molecular formula C19H16ClF4N3O2S and a molecular weight of 461.9 g/mol. IUPAC name: 3-chloro-4-[(2R)-4-[4-fluoro-2-(trifluoromethyl)phenyl]-2-methylpiperazin-1-yl]sulfonylbenzonitrile. InChIKey: CZCHJZVFTFTEAX-GFCCVEGCSA-N.
| Molecular formula | C19H16ClF4N3O2S |
|---|---|
| Molecular weight | 461.9 g/mol |
| IUPAC name | 3-chloro-4-[(2R)-4-[4-fluoro-2-(trifluoromethyl)phenyl]-2-methylpiperazin-1-yl]sulfonylbenzonitrile |
| InChIKey | CZCHJZVFTFTEAX-GFCCVEGCSA-N |
| SMILES | C[C@@H]1CN(CCN1S(=O)(=O)C2=C(C=C(C=C2)C#N)Cl)C3=C(C=C(C=C3)F)C(F)(F)F |
Computed by PubChem (NCBI)