CAS 946513-36-6 is the registry number for Beta-Phenyllongifolol, >95% (HPLC). Offered by: TRC. Available pack sizes: 1mg, 2,5mg, 5mg.
(S)-phenyl-[(8R,9R)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl]methanol (CAS 946513-36-6) is a chemical compound with the molecular formula C21H30O and a molecular weight of 298.5 g/mol. IUPAC name: (S)-phenyl-[(8R,9R)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl]methanol. InChIKey: FGZVLGOUUPQOAB-JOWTXAJYSA-N.
| Molecular formula | C21H30O |
|---|---|
| Molecular weight | 298.5 g/mol |
| IUPAC name | (S)-phenyl-[(8R,9R)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl]methanol |
| InChIKey | FGZVLGOUUPQOAB-JOWTXAJYSA-N |
| SMILES | CC1(CCCC2([C@@H]([C@H]3C1C2CC3)[C@@H](C4=CC=CC=C4)O)C)C |
Computed by PubChem (NCBI)