Products 946524-37-4
CAS 946524-37-4 appears in our catalog under these names: 2-Oleoyl Glycerol-d5, 2-Oleoylglycerol-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
(1,1,2,3,3-pentadeuterio-1,3-dihydroxypropan-2-yl) (Z)-octadec-9-enoate (CAS 946524-37-4) is a chemical compound with the molecular formula C21H40O4 and a molecular weight of 361.6 g/mol. IUPAC name: (1,1,2,3,3-pentadeuterio-1,3-dihydroxypropan-2-yl) (Z)-octadec-9-enoate. InChIKey: UPWGQKDVAURUGE-FNKKQMTJSA-N.
| Molecular formula | C21H40O4 |
|---|---|
| Molecular weight | 361.6 g/mol |
| IUPAC name | (1,1,2,3,3-pentadeuterio-1,3-dihydroxypropan-2-yl) (Z)-octadec-9-enoate |
| InChIKey | UPWGQKDVAURUGE-FNKKQMTJSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])O)OC(=O)CCCCCCC/C=C\CCCCCCCC)O |
Computed by PubChem (NCBI)