CAS 946603-07-2 is the registry number for OSL-95II. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3R,4R,5S)-1-[5-(1-hydroxycyclohexyl)pentyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (CAS 946603-07-2) is a chemical compound with the molecular formula C17H33NO5 and a molecular weight of 331.4 g/mol. IUPAC name: (2R,3R,4R,5S)-1-[5-(1-hydroxycyclohexyl)pentyl]-2-(hydroxymethyl)piperidine-3,4,5-triol. InChIKey: FQNCRPHSICYZQC-QKPAOTATSA-N.
| Molecular formula | C17H33NO5 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | (2R,3R,4R,5S)-1-[5-(1-hydroxycyclohexyl)pentyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| InChIKey | FQNCRPHSICYZQC-QKPAOTATSA-N |
| SMILES | C1CCC(CC1)(CCCCCN2C[C@@H]([C@H]([C@@H]([C@H]2CO)O)O)O)O |
Computed by PubChem (NCBI)