CAS 946605-34-1 is the registry number for Methyl 5-formyl-3-(trifluoroacetamido)thiophene-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 5-formyl-3-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxylate (CAS 946605-34-1) is a chemical compound with the molecular formula C9H6F3NO4S and a molecular weight of 281.21 g/mol. IUPAC name: methyl 5-formyl-3-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxylate. InChIKey: ZNJJBYNPENUHBC-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO4S |
|---|---|
| Molecular weight | 281.21 g/mol |
| IUPAC name | methyl 5-formyl-3-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxylate |
| InChIKey | ZNJJBYNPENUHBC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(S1)C=O)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)