Products 94662-62-1
CAS 94662-62-1 is the registry number for (2Z)-2-(Nitromethylidene)pyrrolidine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2Z)-2-(nitromethylidene)pyrrolidine (CAS 94662-62-1) is a chemical compound with the molecular formula C5H8N2O2 and a molecular weight of 128.13 g/mol. IUPAC name: (2Z)-2-(nitromethylidene)pyrrolidine. InChIKey: LKMGDZMCCPSUFI-PLNGDYQASA-N.
| Molecular formula | C5H8N2O2 |
|---|---|
| Molecular weight | 128.13 g/mol |
| IUPAC name | (2Z)-2-(nitromethylidene)pyrrolidine |
| InChIKey | LKMGDZMCCPSUFI-PLNGDYQASA-N |
| SMILES | C1C/C(=C/[N+](=O)[O-])/NC1 |
Computed by PubChem (NCBI)